C27H25F8NO5S2 — CID 118208050
(4-ethenyl-1,1-dioxothian-4-yl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone (PubChem CID 118208050) has the molecular formula C27H25F8NO5S2 and a molecular weight of 659.62 g/mol. Its IUPAC name is (4-ethenyl-1,1-dioxothian-4-yl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone.
| Compound Name | (4-ethenyl-1,1-dioxothian-4-yl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 118208050 |
| Molecular Formula | C27H25F8NO5S2 |
| Molecular Weight | 659.62 g/mol |
| Exact Mass | 659.10 |
| IUPAC Name | (4-ethenyl-1,1-dioxothian-4-yl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone |
| SMILES | C=CC1(C(=O)N2CC[C@](c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C27H25F8NO5S2/c1-2-23(12-15-42(38,39)16-13-23)22(37)36-14-11-24(17-36,43(40,41)21-9-7-20(28)8-10-21)18-3-5-19(6-4-18)25(29,26(30,31)32)27(33,34)35/h2-10H,1,11-17H2/t24-/m0/s1 |
| InChIKey | KMBNAGHGCKRRBQ-DEOSSOPVSA-N |
| XLogP | 5.40 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.62 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|