C31H28F9NO5S — CID 118208062
tert-butyl 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate (PubChem CID 118208062) has the molecular formula C31H28F9NO5S and a molecular weight of 697.62 g/mol. Its IUPAC name is tert-butyl 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118208062 |
| Molecular Formula | C31H28F9NO5S |
| Molecular Weight | 697.62 g/mol |
| Exact Mass | 697.15 |
| IUPAC Name | tert-butyl 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C31H28F9NO5S/c1-27(2,3)46-26(42)41-16-15-28(18-41,47(43,44)22-13-11-21(32)12-14-22)19-7-9-20(10-8-19)29(30(35,36)37,31(38,39)40)45-17-23-24(33)5-4-6-25(23)34/h4-14H,15-18H2,1-3H3 |
| InChIKey | BPQXFLXFTOEETI-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.62 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |