C24H15F9O3S — CID 118208073
1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylethenyl]phenyl]propan-2-yl]oxymethyl]benzene (PubChem CID 118208073) has the molecular formula C24H15F9O3S and a molecular weight of 554.43 g/mol. Its IUPAC name is 1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylethenyl]phenyl]propan-2-yl]oxymethyl]benzene.
| Compound Name | 1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylethenyl]phenyl]propan-2-yl]oxymethyl]benzene |
|---|---|
| PubChem CID | 118208073 |
| Molecular Formula | C24H15F9O3S |
| Molecular Weight | 554.43 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | 1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylethenyl]phenyl]propan-2-yl]oxymethyl]benzene |
| SMILES | C=C(c1ccc(C(OCc2c(F)cccc2F)(C(F)(F)F)C(F)(F)F)cc1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H15F9O3S/c1-14(37(34,35)18-11-9-17(25)10-12-18)15-5-7-16(8-6-15)22(23(28,29)30,24(31,32)33)36-13-19-20(26)3-2-4-21(19)27/h2-12H,1,13H2 |
| InChIKey | XUJVCVLNDXVLPH-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.43 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |