C25H22F9NO5S2 — CID 118208184
(4-fluoro-1,1-dioxothian-4-yl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone (PubChem CID 118208184) has the molecular formula C25H22F9NO5S2 and a molecular weight of 651.57 g/mol. Its IUPAC name is (4-fluoro-1,1-dioxothian-4-yl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone.
| Compound Name | (4-fluoro-1,1-dioxothian-4-yl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 118208184 |
| Molecular Formula | C25H22F9NO5S2 |
| Molecular Weight | 651.57 g/mol |
| Exact Mass | 651.08 |
| IUPAC Name | (4-fluoro-1,1-dioxothian-4-yl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(N1CC[C@](c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1)C1(F)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C25H22F9NO5S2/c26-18-5-7-19(8-6-18)42(39,40)22(9-12-35(15-22)20(36)21(27)10-13-41(37,38)14-11-21)16-1-3-17(4-2-16)23(28,24(29,30)31)25(32,33)34/h1-8H,9-15H2/t22-/m0/s1 |
| InChIKey | MGPUHNPKOGQNGH-QFIPXVFZSA-N |
| XLogP | 4.93 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |