C20H22FN5 — CID 118208622
4-(1-fluoroethyl)-N-[3-methyl-5-[1-(2-methylprop-2-enyl)pyrazol-4-yl]phenyl]pyrimidin-2-amine (PubChem CID 118208622) has the molecular formula C20H22FN5 and a molecular weight of 351.43 g/mol. Its IUPAC name is 4-(1-fluoroethyl)-N-[3-methyl-5-[1-(2-methylprop-2-enyl)pyrazol-4-yl]phenyl]pyrimidin-2-amine.
| Compound Name | 4-(1-fluoroethyl)-N-[3-methyl-5-[1-(2-methylprop-2-enyl)pyrazol-4-yl]phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 118208622 |
| Molecular Formula | C20H22FN5 |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-(1-fluoroethyl)-N-[3-methyl-5-[1-(2-methylprop-2-enyl)pyrazol-4-yl]phenyl]pyrimidin-2-amine |
| SMILES | C=C(C)Cn1cc(-c2cc(C)cc(Nc3nccc(C(C)F)n3)c2)cn1 |
| InChI | InChI=1S/C20H22FN5/c1-13(2)11-26-12-17(10-23-26)16-7-14(3)8-18(9-16)24-20-22-6-5-19(25-20)15(4)21/h5-10,12,15H,1,11H2,2-4H3,(H,22,24,25) |
| InChIKey | RMPAGGFILQVJBA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|