C18H21ClN4O2 — CID 11820879
(E)-1-[3-[[1-(6-chloropyridazin-3-yl)piperidin-4-yl]methoxy]phenyl]-N-methoxymethanimine (PubChem CID 11820879) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is (E)-1-[3-[[1-(6-chloropyridazin-3-yl)piperidin-4-yl]methoxy]phenyl]-N-methoxymethanimine.
| Compound Name | (E)-1-[3-[[1-(6-chloropyridazin-3-yl)piperidin-4-yl]methoxy]phenyl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 11820879 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (E)-1-[3-[[1-(6-chloropyridazin-3-yl)piperidin-4-yl]methoxy]phenyl]-N-methoxymethanimine |
| SMILES | CO/N=C/c1cccc(OCC2CCN(c3ccc(Cl)nn3)CC2)c1 |
| InChI | InChI=1S/C18H21ClN4O2/c1-24-20-12-15-3-2-4-16(11-15)25-13-14-7-9-23(10-8-14)18-6-5-17(19)21-22-18/h2-6,11-12,14H,7-10,13H2,1H3/b20-12+ |
| InChIKey | FWUOOJUCYOSOIF-UDWIEESQSA-N |
| XLogP | 3.41 |
| TPSA | 59.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|