C32H30F9NO5S — CID 118209041
tert-butyl 4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonylpiperidine-1-carboxylate (PubChem CID 118209041) has the molecular formula C32H30F9NO5S and a molecular weight of 711.64 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 118209041 |
| Molecular Formula | C32H30F9NO5S |
| Molecular Weight | 711.64 g/mol |
| Exact Mass | 711.17 |
| IUPAC Name | tert-butyl 4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C32H30F9NO5S/c1-28(2,3)47-27(43)42-17-15-29(16-18-42,48(44,45)23-13-11-22(33)12-14-23)20-7-9-21(10-8-20)30(31(36,37)38,32(39,40)41)46-19-24-25(34)5-4-6-26(24)35/h4-14H,15-19H2,1-3H3 |
| InChIKey | ATWDSVMKVQYHBH-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.64 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |