C18H13F4N3O2 — CID 118209253
ethyl 1-[3-fluoro-4-(trifluoromethyl)phenyl]-5-pyridin-3-ylpyrazole-3-carboxylate (PubChem CID 118209253) has the molecular formula C18H13F4N3O2 and a molecular weight of 379.31 g/mol. Its IUPAC name is ethyl 1-[3-fluoro-4-(trifluoromethyl)phenyl]-5-pyridin-3-ylpyrazole-3-carboxylate.
| Compound Name | ethyl 1-[3-fluoro-4-(trifluoromethyl)phenyl]-5-pyridin-3-ylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 118209253 |
| Molecular Formula | C18H13F4N3O2 |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | ethyl 1-[3-fluoro-4-(trifluoromethyl)phenyl]-5-pyridin-3-ylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccnc2)n(-c2ccc(C(F)(F)F)c(F)c2)n1 |
| InChI | InChI=1S/C18H13F4N3O2/c1-2-27-17(26)15-9-16(11-4-3-7-23-10-11)25(24-15)12-5-6-13(14(19)8-12)18(20,21)22/h3-10H,2H2,1H3 |
| InChIKey | JUARIWAZMZKCPE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |