C33H29F9O6S — CID 118209343
tert-butyl 5-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-5-(4-fluorophenyl)sulfonyl-2-oxocyclohexane-1-carboxylate (PubChem CID 118209343) has the molecular formula C33H29F9O6S and a molecular weight of 724.64 g/mol. Its IUPAC name is tert-butyl 5-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-5-(4-fluorophenyl)sulfonyl-2-oxocyclohexane-1-carboxylate.
| Compound Name | tert-butyl 5-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-5-(4-fluorophenyl)sulfonyl-2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118209343 |
| Molecular Formula | C33H29F9O6S |
| Molecular Weight | 724.64 g/mol |
| Exact Mass | 724.15 |
| IUPAC Name | tert-butyl 5-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-5-(4-fluorophenyl)sulfonyl-2-oxocyclohexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CC(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CCC1=O |
| InChI | InChI=1S/C33H29F9O6S/c1-29(2,3)48-28(44)23-17-30(16-15-27(23)43,49(45,46)22-13-11-21(34)12-14-22)19-7-9-20(10-8-19)31(32(37,38)39,33(40,41)42)47-18-24-25(35)5-4-6-26(24)36/h4-14,23H,15-18H2,1-3H3 |
| InChIKey | MRQNMQXBEHOVRY-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.64 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|