C29H26F8N2O3S — CID 118209362
N-[(2R,4R)-4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-methylcyclohexyl]-2-pyridin-4-ylacetamide (PubChem CID 118209362) has the molecular formula C29H26F8N2O3S and a molecular weight of 634.59 g/mol. Its IUPAC name is N-[(2R,4R)-4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-methylcyclohexyl]-2-pyridin-4-ylacetamide.
| Compound Name | N-[(2R,4R)-4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-methylcyclohexyl]-2-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 118209362 |
| Molecular Formula | C29H26F8N2O3S |
| Molecular Weight | 634.59 g/mol |
| Exact Mass | 634.15 |
| IUPAC Name | N-[(2R,4R)-4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-methylcyclohexyl]-2-pyridin-4-ylacetamide |
| SMILES | C[C@@H]1C[C@](c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CCC1NC(=O)Cc1ccncc1 |
| InChI | InChI=1S/C29H26F8N2O3S/c1-18-17-26(43(41,42)23-8-6-22(30)7-9-23,13-10-24(18)39-25(40)16-19-11-14-38-15-12-19)20-2-4-21(5-3-20)27(31,28(32,33)34)29(35,36)37/h2-9,11-12,14-15,18,24H,10,13,16-17H2,1H3,(H,39,40)/t18-,24?,26-/m1/s1 |
| InChIKey | IYGFTEMKTXNAPL-WHOXIPFLSA-N |
| XLogP | 6.73 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.59 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |