C22H23ClF7NO3S — CID 118209403
2-[4-[(1S,3R)-4-amino-1-(4-fluorophenyl)sulfonyl-3-methylcyclohexyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;hydrochloride (PubChem CID 118209403) has the molecular formula C22H23ClF7NO3S and a molecular weight of 549.94 g/mol. Its IUPAC name is 2-[4-[(1S,3R)-4-amino-1-(4-fluorophenyl)sulfonyl-3-methylcyclohexyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;hydrochloride.
| Compound Name | 2-[4-[(1S,3R)-4-amino-1-(4-fluorophenyl)sulfonyl-3-methylcyclohexyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 118209403 |
| Molecular Formula | C22H23ClF7NO3S |
| Molecular Weight | 549.94 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | 2-[4-[(1S,3R)-4-amino-1-(4-fluorophenyl)sulfonyl-3-methylcyclohexyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;hydrochloride |
| SMILES | C[C@@H]1C[C@@](c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CCC1N.Cl |
| InChI | InChI=1S/C22H22F7NO3S.ClH/c1-13-12-19(11-10-18(13)30,34(32,33)17-8-6-16(23)7-9-17)14-2-4-15(5-3-14)20(31,21(24,25)26)22(27,28)29;/h2-9,13,18,31H,10-12,30H2,1H3;1H/t13-,18?,19+;/m1./s1 |
| InChIKey | FSFXYIVVUIQHRK-VVUKEGRVSA-N |
| XLogP | 5.38 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.94 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |