C13H11FN6 — CID 118209477
4-(2-fluoro-4-pyridinyl)-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine (PubChem CID 118209477) has the molecular formula C13H11FN6 and a molecular weight of 270.27 g/mol. Its IUPAC name is 4-(2-fluoro-4-pyridinyl)-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine.
| Compound Name | 4-(2-fluoro-4-pyridinyl)-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 118209477 |
| Molecular Formula | C13H11FN6 |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-(2-fluoro-4-pyridinyl)-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine |
| SMILES | Cn1nccc1Nc1nccc(-c2ccnc(F)c2)n1 |
| InChI | InChI=1S/C13H11FN6/c1-20-12(4-7-17-20)19-13-16-6-3-10(18-13)9-2-5-15-11(14)8-9/h2-8H,1H3,(H,16,18,19) |
| InChIKey | CCRACUQLURPMQO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|