About 8-thiaspiro[4.5]decane
8-thiaspiro[4.5]decane (PubChem CID 118209870) has the molecular formula C9H16S
and a molecular weight of 156.29 g/mol. Its IUPAC name is 8-thiaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-thiaspiro[4.5]decane |
| PubChem CID | 118209870 |
| Molecular Formula | C9H16S |
| Molecular Weight | 156.29 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 8-thiaspiro[4.5]decane |
| SMILES | C1CCC2(C1)CCSCC2 |
| InChI | InChI=1S/C9H16S/c1-2-4-9(3-1)5-7-10-8-6-9/h1-8H2 |
| InChIKey | SQIKLUOMQXHAGA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-thiaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-thiaspiro[4.5]decane?
The IUPAC name of 8-thiaspiro[4.5]decane (CID 118209870) is 8-thiaspiro[4.5]decane.
What is the SMILES notation for 8-thiaspiro[4.5]decane?
The canonical SMILES for 8-thiaspiro[4.5]decane is C1CCC2(C1)CCSCC2.
What is the InChIKey of 8-thiaspiro[4.5]decane?
The InChIKey is SQIKLUOMQXHAGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16S/c1-2-4-9(3-1)5-7-10-8-6-9/h1-8H2.
What are the key properties of 8-thiaspiro[4.5]decane?
8-thiaspiro[4.5]decane has a molecular weight of 156.29 g/mol, XLogP of 3.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-thiaspiro[4.5]decane is sourced from PubChem (CID 118209870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).