About 10-thia-2,6-diazaspiro[4.6]undecane
10-thia-2,6-diazaspiro[4.6]undecane (PubChem CID 118210381) has the molecular formula C8H16N2S
and a molecular weight of 172.30 g/mol. Its IUPAC name is 10-thia-2,6-diazaspiro[4.6]undecane.
Molecular Properties
| Compound Name | 10-thia-2,6-diazaspiro[4.6]undecane |
| PubChem CID | 118210381 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 10-thia-2,6-diazaspiro[4.6]undecane |
| SMILES | C1CNC2(CCNC2)CSC1 |
| InChI | InChI=1S/C8H16N2S/c1-3-10-8(7-11-5-1)2-4-9-6-8/h9-10H,1-7H2 |
| InChIKey | NYIUWPMZVNUXGF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10-thia-2,6-diazaspiro[4.6]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-thia-2,6-diazaspiro[4.6]undecane?
The IUPAC name of 10-thia-2,6-diazaspiro[4.6]undecane (CID 118210381) is 10-thia-2,6-diazaspiro[4.6]undecane.
What is the SMILES notation for 10-thia-2,6-diazaspiro[4.6]undecane?
The canonical SMILES for 10-thia-2,6-diazaspiro[4.6]undecane is C1CNC2(CCNC2)CSC1.
What is the InChIKey of 10-thia-2,6-diazaspiro[4.6]undecane?
The InChIKey is NYIUWPMZVNUXGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2S/c1-3-10-8(7-11-5-1)2-4-9-6-8/h9-10H,1-7H2.
What are the key properties of 10-thia-2,6-diazaspiro[4.6]undecane?
10-thia-2,6-diazaspiro[4.6]undecane has a molecular weight of 172.30 g/mol, XLogP of 0.44, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-thia-2,6-diazaspiro[4.6]undecane is sourced from PubChem (CID 118210381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).