About 2-cyclopropyl-2-(2,4-dinitrophenoxy)-N-methyl-2-phenylethanamine
2-cyclopropyl-2-(2,4-dinitrophenoxy)-N-methyl-2-phenylethanamine (PubChem CID 118210723) has the molecular formula C18H19N3O5
and a molecular weight of 357.37 g/mol. Its IUPAC name is 2-cyclopropyl-2-(2,4-dinitrophenoxy)-N-methyl-2-phenylethanamine.
Molecular Properties
| Compound Name | 2-cyclopropyl-2-(2,4-dinitrophenoxy)-N-methyl-2-phenylethanamine |
| PubChem CID | 118210723 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-cyclopropyl-2-(2,4-dinitrophenoxy)-N-methyl-2-phenylethanamine |
| SMILES | CNCC(Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])(c1ccccc1)C1CC1 |
| InChI | InChI=1S/C18H19N3O5/c1-19-12-18(14-7-8-14,13-5-3-2-4-6-13)26-17-10-9-15(20(22)23)11-16(17)21(24)25/h2-6,9-11,14,19H,7-8,12H2,1H3 |
| InChIKey | HQZWVTXGTMVXLC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropyl-2-(2,4-dinitrophenoxy)-N-methyl-2-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-2-(2,4-dinitrophenoxy)-N-methyl-2-phenylethanamine?
The IUPAC name of 2-cyclopropyl-2-(2,4-dinitrophenoxy)-N-methyl-2-phenylethanamine (CID 118210723) is 2-cyclopropyl-2-(2,4-dinitrophenoxy)-N-methyl-2-phenylethanamine.
What is the SMILES notation for 2-cyclopropyl-2-(2,4-dinitrophenoxy)-N-methyl-2-phenylethanamine?
The canonical SMILES for 2-cyclopropyl-2-(2,4-dinitrophenoxy)-N-methyl-2-phenylethanamine is CNCC(Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])(c1ccccc1)C1CC1.
What is the InChIKey of 2-cyclopropyl-2-(2,4-dinitrophenoxy)-N-methyl-2-phenylethanamine?
The InChIKey is HQZWVTXGTMVXLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O5/c1-19-12-18(14-7-8-14,13-5-3-2-4-6-13)26-17-10-9-15(20(22)23)11-16(17)21(24)25/h2-6,9-11,14,19H,7-8,12H2,1H3.
What are the key properties of 2-cyclopropyl-2-(2,4-dinitrophenoxy)-N-methyl-2-phenylethanamine?
2-cyclopropyl-2-(2,4-dinitrophenoxy)-N-methyl-2-phenylethanamine has a molecular weight of 357.37 g/mol, XLogP of 3.41, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2-(2,4-dinitrophenoxy)-N-methyl-2-phenylethanamine is sourced from PubChem (CID 118210723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).