C15H17N3S2 — CID 118210900
7,7-dimethyl-2-sulfanylidene-4-(1,3-thiazol-5-yl)-1,3,4,5,6,8-hexahydroquinoline-3-carbonitrile (PubChem CID 118210900) has the molecular formula C15H17N3S2 and a molecular weight of 303.46 g/mol. Its IUPAC name is 7,7-dimethyl-2-sulfanylidene-4-(1,3-thiazol-5-yl)-1,3,4,5,6,8-hexahydroquinoline-3-carbonitrile.
| Compound Name | 7,7-dimethyl-2-sulfanylidene-4-(1,3-thiazol-5-yl)-1,3,4,5,6,8-hexahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 118210900 |
| Molecular Formula | C15H17N3S2 |
| Molecular Weight | 303.46 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 7,7-dimethyl-2-sulfanylidene-4-(1,3-thiazol-5-yl)-1,3,4,5,6,8-hexahydroquinoline-3-carbonitrile |
| SMILES | CC1(C)CCC2=C(C1)NC(=S)C(C#N)C2c1cncs1 |
| InChI | InChI=1S/C15H17N3S2/c1-15(2)4-3-9-11(5-15)18-14(19)10(6-16)13(9)12-7-17-8-20-12/h7-8,10,13H,3-5H2,1-2H3,(H,18,19) |
| InChIKey | JGUVQPRUCYQKRG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|