C17H18ClF3N2O4S — CID 118211049
1-[(Z)-4-chlorobut-2-enyl]-5,5-dimethyl-3-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione (PubChem CID 118211049) has the molecular formula C17H18ClF3N2O4S and a molecular weight of 438.86 g/mol. Its IUPAC name is 1-[(Z)-4-chlorobut-2-enyl]-5,5-dimethyl-3-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 1-[(Z)-4-chlorobut-2-enyl]-5,5-dimethyl-3-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118211049 |
| Molecular Formula | C17H18ClF3N2O4S |
| Molecular Weight | 438.86 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 1-[(Z)-4-chlorobut-2-enyl]-5,5-dimethyl-3-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)N(c2ccc(S(C)(=O)=O)c(C(F)(F)F)c2)C(=O)N1C/C=C\CCl |
| InChI | InChI=1S/C17H18ClF3N2O4S/c1-16(2)14(24)23(15(25)22(16)9-5-4-8-18)11-6-7-13(28(3,26)27)12(10-11)17(19,20)21/h4-7,10H,8-9H2,1-3H3/b5-4- |
| InChIKey | INYLVXLQAFOLKO-PLNGDYQASA-N |
| XLogP | 3.45 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.86 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|