About N,N-dipropyl-4-pyrrolidin-1-yl-1,3-thiazol-2-amine
N,N-dipropyl-4-pyrrolidin-1-yl-1,3-thiazol-2-amine (PubChem CID 11821116) has the molecular formula C13H23N3S
and a molecular weight of 253.41 g/mol. Its IUPAC name is N,N-dipropyl-4-pyrrolidin-1-yl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N,N-dipropyl-4-pyrrolidin-1-yl-1,3-thiazol-2-amine |
| PubChem CID | 11821116 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | N,N-dipropyl-4-pyrrolidin-1-yl-1,3-thiazol-2-amine |
| SMILES | CCCN(CCC)c1nc(N2CCCC2)cs1 |
| InChI | InChI=1S/C13H23N3S/c1-3-7-16(8-4-2)13-14-12(11-17-13)15-9-5-6-10-15/h11H,3-10H2,1-2H3 |
| InChIKey | YDTBBDSEYAEONW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dipropyl-4-pyrrolidin-1-yl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dipropyl-4-pyrrolidin-1-yl-1,3-thiazol-2-amine?
The IUPAC name of N,N-dipropyl-4-pyrrolidin-1-yl-1,3-thiazol-2-amine (CID 11821116) is N,N-dipropyl-4-pyrrolidin-1-yl-1,3-thiazol-2-amine.
What is the SMILES notation for N,N-dipropyl-4-pyrrolidin-1-yl-1,3-thiazol-2-amine?
The canonical SMILES for N,N-dipropyl-4-pyrrolidin-1-yl-1,3-thiazol-2-amine is CCCN(CCC)c1nc(N2CCCC2)cs1.
What is the InChIKey of N,N-dipropyl-4-pyrrolidin-1-yl-1,3-thiazol-2-amine?
The InChIKey is YDTBBDSEYAEONW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3S/c1-3-7-16(8-4-2)13-14-12(11-17-13)15-9-5-6-10-15/h11H,3-10H2,1-2H3.
What are the key properties of N,N-dipropyl-4-pyrrolidin-1-yl-1,3-thiazol-2-amine?
N,N-dipropyl-4-pyrrolidin-1-yl-1,3-thiazol-2-amine has a molecular weight of 253.41 g/mol, XLogP of 3.37, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dipropyl-4-pyrrolidin-1-yl-1,3-thiazol-2-amine is sourced from PubChem (CID 11821116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).