C25H18N6O — CID 118211468
5-(benzimidazol-1-ylamino)-3-(4-phenylmethoxyphenyl)pyrazine-2-carbonitrile (PubChem CID 118211468) has the molecular formula C25H18N6O and a molecular weight of 418.46 g/mol. Its IUPAC name is 5-(benzimidazol-1-ylamino)-3-(4-phenylmethoxyphenyl)pyrazine-2-carbonitrile.
| Compound Name | 5-(benzimidazol-1-ylamino)-3-(4-phenylmethoxyphenyl)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 118211468 |
| Molecular Formula | C25H18N6O |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 5-(benzimidazol-1-ylamino)-3-(4-phenylmethoxyphenyl)pyrazine-2-carbonitrile |
| SMILES | N#Cc1ncc(Nn2cnc3ccccc32)nc1-c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H18N6O/c26-14-22-25(19-10-12-20(13-11-19)32-16-18-6-2-1-3-7-18)29-24(15-27-22)30-31-17-28-21-8-4-5-9-23(21)31/h1-13,15,17H,16H2,(H,29,30) |
| InChIKey | VUMHRMWFRPVTNU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |