C30H25F9O5S — CID 118212059
trans-tert-butyl (1R,2S)-2-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-(4-fluorophenyl)sulfonylcyclopropane-1-carboxylate (PubChem CID 118212059) has the molecular formula C30H25F9O5S and a molecular weight of 668.57 g/mol. Its IUPAC name is trans-tert-butyl (1R,2S)-2-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-(4-fluorophenyl)sulfonylcyclopropane-1-carboxylate.
| Compound Name | trans-tert-butyl (1R,2S)-2-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-(4-fluorophenyl)sulfonylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 118212059 |
| Molecular Formula | C30H25F9O5S |
| Molecular Weight | 668.57 g/mol |
| Exact Mass | 668.13 |
| IUPAC Name | trans-tert-butyl (1R,2S)-2-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-(4-fluorophenyl)sulfonylcyclopropane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1C[C@]1(c1ccc(C(OCc2c(F)cccc2F)(C(F)(F)F)C(F)(F)F)cc1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H25F9O5S/c1-26(2,3)44-25(40)22-15-27(22,45(41,42)20-13-11-19(31)12-14-20)17-7-9-18(10-8-17)28(29(34,35)36,30(37,38)39)43-16-21-23(32)5-4-6-24(21)33/h4-14,22H,15-16H2,1-3H3/t22-,27-/m1/s1 |
| InChIKey | MHQMJCZJKLPQFI-AJTFRIOCSA-N |
| XLogP | 7.67 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.57 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |