C19H16F6O2S — CID 118212095
1-[1-(4-fluorophenyl)sulfonylcyclopentyl]-4-(1,1,2,2,2-pentafluoroethyl)benzene (PubChem CID 118212095) has the molecular formula C19H16F6O2S and a molecular weight of 422.39 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)sulfonylcyclopentyl]-4-(1,1,2,2,2-pentafluoroethyl)benzene.
| Compound Name | 1-[1-(4-fluorophenyl)sulfonylcyclopentyl]-4-(1,1,2,2,2-pentafluoroethyl)benzene |
|---|---|
| PubChem CID | 118212095 |
| Molecular Formula | C19H16F6O2S |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 1-[1-(4-fluorophenyl)sulfonylcyclopentyl]-4-(1,1,2,2,2-pentafluoroethyl)benzene |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1(c2ccc(C(F)(F)C(F)(F)F)cc2)CCCC1 |
| InChI | InChI=1S/C19H16F6O2S/c20-15-7-9-16(10-8-15)28(26,27)17(11-1-2-12-17)13-3-5-14(6-4-13)18(21,22)19(23,24)25/h3-10H,1-2,11-12H2 |
| InChIKey | KJBOMDJCASACMS-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|