C6H7N3O4 — CID 118212121
1-[[(2S)-oxiran-2-yl]methyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 118212121) has the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. Its IUPAC name is 1-[[(2S)-oxiran-2-yl]methyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[[(2S)-oxiran-2-yl]methyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 118212121 |
| Molecular Formula | C6H7N3O4 |
| Molecular Weight | 185.14 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | 1-[[(2S)-oxiran-2-yl]methyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1[nH]c(=O)n(C[C@H]2CO2)c(=O)[nH]1 |
| InChI | InChI=1S/C6H7N3O4/c10-4-7-5(11)9(6(12)8-4)1-3-2-13-3/h3H,1-2H2,(H2,7,8,10,11,12)/t3-/m0/s1 |
| InChIKey | NBZYOWJKOWTTRO-VKHMYHEASA-N |
| XLogP | -2.38 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.14 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|