C27H19F9O3S — CID 118212173
1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonyl-3-methylidenecyclobutyl]phenyl]propan-2-yl]oxymethyl]benzene (PubChem CID 118212173) has the molecular formula C27H19F9O3S and a molecular weight of 594.50 g/mol. Its IUPAC name is 1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonyl-3-methylidenecyclobutyl]phenyl]propan-2-yl]oxymethyl]benzene.
| Compound Name | 1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonyl-3-methylidenecyclobutyl]phenyl]propan-2-yl]oxymethyl]benzene |
|---|---|
| PubChem CID | 118212173 |
| Molecular Formula | C27H19F9O3S |
| Molecular Weight | 594.50 g/mol |
| Exact Mass | 594.09 |
| IUPAC Name | 1,3-difluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonyl-3-methylidenecyclobutyl]phenyl]propan-2-yl]oxymethyl]benzene |
| SMILES | C=C1CC(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C27H19F9O3S/c1-16-13-24(14-16,40(37,38)20-11-9-19(28)10-12-20)17-5-7-18(8-6-17)25(26(31,32)33,27(34,35)36)39-15-21-22(29)3-2-4-23(21)30/h2-12H,1,13-15H2 |
| InChIKey | IQKRZTHDYGQRRK-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.50 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|