About trimethyl-(4-trimethylsilyloxycyclohexa-1,3-dien-1-yl)oxysilane
trimethyl-(4-trimethylsilyloxycyclohexa-1,3-dien-1-yl)oxysilane (PubChem CID 11821222) has the molecular formula C12H24O2Si2
and a molecular weight of 256.49 g/mol. Its IUPAC name is trimethyl-(4-trimethylsilyloxycyclohexa-1,3-dien-1-yl)oxysilane.
Molecular Properties
| Compound Name | trimethyl-(4-trimethylsilyloxycyclohexa-1,3-dien-1-yl)oxysilane |
| PubChem CID | 11821222 |
| Molecular Formula | C12H24O2Si2 |
| Molecular Weight | 256.49 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | trimethyl-(4-trimethylsilyloxycyclohexa-1,3-dien-1-yl)oxysilane |
| SMILES | C[Si](C)(C)OC1=CC=C(O[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C12H24O2Si2/c1-15(2,3)13-11-7-9-12(10-8-11)14-16(4,5)6/h7,9H,8,10H2,1-6H3 |
| InChIKey | UZRWNVMXGMUSCS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-(4-trimethylsilyloxycyclohexa-1,3-dien-1-yl)oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-(4-trimethylsilyloxycyclohexa-1,3-dien-1-yl)oxysilane?
The IUPAC name of trimethyl-(4-trimethylsilyloxycyclohexa-1,3-dien-1-yl)oxysilane (CID 11821222) is trimethyl-(4-trimethylsilyloxycyclohexa-1,3-dien-1-yl)oxysilane.
What is the SMILES notation for trimethyl-(4-trimethylsilyloxycyclohexa-1,3-dien-1-yl)oxysilane?
The canonical SMILES for trimethyl-(4-trimethylsilyloxycyclohexa-1,3-dien-1-yl)oxysilane is C[Si](C)(C)OC1=CC=C(O[Si](C)(C)C)CC1.
What is the InChIKey of trimethyl-(4-trimethylsilyloxycyclohexa-1,3-dien-1-yl)oxysilane?
The InChIKey is UZRWNVMXGMUSCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2Si2/c1-15(2,3)13-11-7-9-12(10-8-11)14-16(4,5)6/h7,9H,8,10H2,1-6H3.
What are the key properties of trimethyl-(4-trimethylsilyloxycyclohexa-1,3-dien-1-yl)oxysilane?
trimethyl-(4-trimethylsilyloxycyclohexa-1,3-dien-1-yl)oxysilane has a molecular weight of 256.49 g/mol, XLogP of 4.25, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-(4-trimethylsilyloxycyclohexa-1,3-dien-1-yl)oxysilane is sourced from PubChem (CID 11821222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).