C28H21F9O5S — CID 118212304
3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclopentane-1-carboxylic acid (PubChem CID 118212304) has the molecular formula C28H21F9O5S and a molecular weight of 640.52 g/mol. Its IUPAC name is 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclopentane-1-carboxylic acid.
| Compound Name | 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 118212304 |
| Molecular Formula | C28H21F9O5S |
| Molecular Weight | 640.52 g/mol |
| Exact Mass | 640.10 |
| IUPAC Name | 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylcyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C28H21F9O5S/c29-19-8-10-20(11-9-19)43(40,41)25(13-12-16(14-25)24(38)39)17-4-6-18(7-5-17)26(27(32,33)34,28(35,36)37)42-15-21-22(30)2-1-3-23(21)31/h1-11,16H,12-15H2,(H,38,39) |
| InChIKey | POHUGWWERDRLAU-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.52 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |