About N-[[2,5-difluoro-4-(hydroxymethyl)phenyl]methyl]acetamide
N-[[2,5-difluoro-4-(hydroxymethyl)phenyl]methyl]acetamide (PubChem CID 118212468) has the molecular formula C10H11F2NO2
and a molecular weight of 215.20 g/mol. Its IUPAC name is N-[[2,5-difluoro-4-(hydroxymethyl)phenyl]methyl]acetamide.
Molecular Properties
| Compound Name | N-[[2,5-difluoro-4-(hydroxymethyl)phenyl]methyl]acetamide |
| PubChem CID | 118212468 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | N-[[2,5-difluoro-4-(hydroxymethyl)phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1cc(F)c(CO)cc1F |
| InChI | InChI=1S/C10H11F2NO2/c1-6(15)13-4-7-2-10(12)8(5-14)3-9(7)11/h2-3,14H,4-5H2,1H3,(H,13,15) |
| InChIKey | GOTWDXUDNHYPPU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[2,5-difluoro-4-(hydroxymethyl)phenyl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2,5-difluoro-4-(hydroxymethyl)phenyl]methyl]acetamide?
The IUPAC name of N-[[2,5-difluoro-4-(hydroxymethyl)phenyl]methyl]acetamide (CID 118212468) is N-[[2,5-difluoro-4-(hydroxymethyl)phenyl]methyl]acetamide.
What is the SMILES notation for N-[[2,5-difluoro-4-(hydroxymethyl)phenyl]methyl]acetamide?
The canonical SMILES for N-[[2,5-difluoro-4-(hydroxymethyl)phenyl]methyl]acetamide is CC(=O)NCc1cc(F)c(CO)cc1F.
What is the InChIKey of N-[[2,5-difluoro-4-(hydroxymethyl)phenyl]methyl]acetamide?
The InChIKey is GOTWDXUDNHYPPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO2/c1-6(15)13-4-7-2-10(12)8(5-14)3-9(7)11/h2-3,14H,4-5H2,1H3,(H,13,15).
What are the key properties of N-[[2,5-difluoro-4-(hydroxymethyl)phenyl]methyl]acetamide?
N-[[2,5-difluoro-4-(hydroxymethyl)phenyl]methyl]acetamide has a molecular weight of 215.20 g/mol, XLogP of 1.09, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2,5-difluoro-4-(hydroxymethyl)phenyl]methyl]acetamide is sourced from PubChem (CID 118212468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).