About methyl 1-[[2,3-difluoro-4-(hydroxymethyl)phenyl]methyl]-6-oxopyridine-3-carboxylate
methyl 1-[[2,3-difluoro-4-(hydroxymethyl)phenyl]methyl]-6-oxopyridine-3-carboxylate (PubChem CID 118212556) has the molecular formula C15H13F2NO4
and a molecular weight of 309.27 g/mol. Its IUPAC name is methyl 1-[[2,3-difluoro-4-(hydroxymethyl)phenyl]methyl]-6-oxopyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[[2,3-difluoro-4-(hydroxymethyl)phenyl]methyl]-6-oxopyridine-3-carboxylate |
| PubChem CID | 118212556 |
| Molecular Formula | C15H13F2NO4 |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | methyl 1-[[2,3-difluoro-4-(hydroxymethyl)phenyl]methyl]-6-oxopyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(=O)n(Cc2ccc(CO)c(F)c2F)c1 |
| InChI | InChI=1S/C15H13F2NO4/c1-22-15(21)10-4-5-12(20)18(7-10)6-9-2-3-11(8-19)14(17)13(9)16/h2-5,7,19H,6,8H2,1H3 |
| InChIKey | LHAUMODPXSGGRI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-[[2,3-difluoro-4-(hydroxymethyl)phenyl]methyl]-6-oxopyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[[2,3-difluoro-4-(hydroxymethyl)phenyl]methyl]-6-oxopyridine-3-carboxylate?
The IUPAC name of methyl 1-[[2,3-difluoro-4-(hydroxymethyl)phenyl]methyl]-6-oxopyridine-3-carboxylate (CID 118212556) is methyl 1-[[2,3-difluoro-4-(hydroxymethyl)phenyl]methyl]-6-oxopyridine-3-carboxylate.
What is the SMILES notation for methyl 1-[[2,3-difluoro-4-(hydroxymethyl)phenyl]methyl]-6-oxopyridine-3-carboxylate?
The canonical SMILES for methyl 1-[[2,3-difluoro-4-(hydroxymethyl)phenyl]methyl]-6-oxopyridine-3-carboxylate is COC(=O)c1ccc(=O)n(Cc2ccc(CO)c(F)c2F)c1.
What is the InChIKey of methyl 1-[[2,3-difluoro-4-(hydroxymethyl)phenyl]methyl]-6-oxopyridine-3-carboxylate?
The InChIKey is LHAUMODPXSGGRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F2NO4/c1-22-15(21)10-4-5-12(20)18(7-10)6-9-2-3-11(8-19)14(17)13(9)16/h2-5,7,19H,6,8H2,1H3.
What are the key properties of methyl 1-[[2,3-difluoro-4-(hydroxymethyl)phenyl]methyl]-6-oxopyridine-3-carboxylate?
methyl 1-[[2,3-difluoro-4-(hydroxymethyl)phenyl]methyl]-6-oxopyridine-3-carboxylate has a molecular weight of 309.27 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[[2,3-difluoro-4-(hydroxymethyl)phenyl]methyl]-6-oxopyridine-3-carboxylate is sourced from PubChem (CID 118212556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).