C12H18O6 — CID 11821261
(3aR,4R,7S,7aS)-7-hydroxy-4-(hydroxymethyl)spiro[3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-6-one (PubChem CID 11821261) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is (3aR,4R,7S,7aS)-7-hydroxy-4-(hydroxymethyl)spiro[3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-6-one.
| Compound Name | (3aR,4R,7S,7aS)-7-hydroxy-4-(hydroxymethyl)spiro[3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-6-one |
|---|---|
| PubChem CID | 11821261 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (3aR,4R,7S,7aS)-7-hydroxy-4-(hydroxymethyl)spiro[3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-6-one |
| SMILES | O=C1O[C@H](CO)[C@H]2OC3(CCCCC3)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C12H18O6/c13-6-7-9-10(8(14)11(15)16-7)18-12(17-9)4-2-1-3-5-12/h7-10,13-14H,1-6H2/t7-,8+,9-,10+/m1/s1 |
| InChIKey | ZSLMAQBHXHRULL-RGOKHQFPSA-N |
| XLogP | -0.29 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |