About 1-ethoxy-3-(2-ethoxyethyl)-7-methyl-3H-2,1λ5-benzoxaphosphole 1-oxide
1-ethoxy-3-(2-ethoxyethyl)-7-methyl-3H-2,1λ5-benzoxaphosphole 1-oxide (PubChem CID 118213342) has the molecular formula C14H21O4P
and a molecular weight of 284.29 g/mol. Its IUPAC name is 1-ethoxy-3-(2-ethoxyethyl)-7-methyl-3H-2,1λ5-benzoxaphosphole 1-oxide.
Molecular Properties
| Compound Name | 1-ethoxy-3-(2-ethoxyethyl)-7-methyl-3H-2,1λ5-benzoxaphosphole 1-oxide |
| PubChem CID | 118213342 |
| Molecular Formula | C14H21O4P |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 1-ethoxy-3-(2-ethoxyethyl)-7-methyl-3H-2,1λ5-benzoxaphosphole 1-oxide |
| SMILES | CCOCCC1OP(=O)(OCC)c2c(C)cccc21 |
| InChI | InChI=1S/C14H21O4P/c1-4-16-10-9-13-12-8-6-7-11(3)14(12)19(15,18-13)17-5-2/h6-8,13H,4-5,9-10H2,1-3H3 |
| InChIKey | JLAJVAPGHNKGFW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-3-(2-ethoxyethyl)-7-methyl-3H-2,1λ5-benzoxaphosphole 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-3-(2-ethoxyethyl)-7-methyl-3H-2,1λ5-benzoxaphosphole 1-oxide?
The IUPAC name of 1-ethoxy-3-(2-ethoxyethyl)-7-methyl-3H-2,1λ5-benzoxaphosphole 1-oxide (CID 118213342) is 1-ethoxy-3-(2-ethoxyethyl)-7-methyl-3H-2,1λ5-benzoxaphosphole 1-oxide.
What is the SMILES notation for 1-ethoxy-3-(2-ethoxyethyl)-7-methyl-3H-2,1λ5-benzoxaphosphole 1-oxide?
The canonical SMILES for 1-ethoxy-3-(2-ethoxyethyl)-7-methyl-3H-2,1λ5-benzoxaphosphole 1-oxide is CCOCCC1OP(=O)(OCC)c2c(C)cccc21.
What is the InChIKey of 1-ethoxy-3-(2-ethoxyethyl)-7-methyl-3H-2,1λ5-benzoxaphosphole 1-oxide?
The InChIKey is JLAJVAPGHNKGFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21O4P/c1-4-16-10-9-13-12-8-6-7-11(3)14(12)19(15,18-13)17-5-2/h6-8,13H,4-5,9-10H2,1-3H3.
What are the key properties of 1-ethoxy-3-(2-ethoxyethyl)-7-methyl-3H-2,1λ5-benzoxaphosphole 1-oxide?
1-ethoxy-3-(2-ethoxyethyl)-7-methyl-3H-2,1λ5-benzoxaphosphole 1-oxide has a molecular weight of 284.29 g/mol, XLogP of 3.35, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-3-(2-ethoxyethyl)-7-methyl-3H-2,1λ5-benzoxaphosphole 1-oxide is sourced from PubChem (CID 118213342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).