C13H15N3O3 — CID 11821375
(3S,7aR)-3-methyl-1-(4-nitrophenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-a]imidazol-2-one (PubChem CID 11821375) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is (3S,7aR)-3-methyl-1-(4-nitrophenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-a]imidazol-2-one.
| Compound Name | (3S,7aR)-3-methyl-1-(4-nitrophenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-a]imidazol-2-one |
|---|---|
| PubChem CID | 11821375 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (3S,7aR)-3-methyl-1-(4-nitrophenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-a]imidazol-2-one |
| SMILES | C[C@H]1C(=O)N(c2ccc([N+](=O)[O-])cc2)[C@@H]2CCCN12 |
| InChI | InChI=1S/C13H15N3O3/c1-9-13(17)15(12-3-2-8-14(9)12)10-4-6-11(7-5-10)16(18)19/h4-7,9,12H,2-3,8H2,1H3/t9-,12+/m0/s1 |
| InChIKey | BSGKVLOVSSZCSP-JOYOIKCWSA-N |
| XLogP | 1.75 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|