C20H26N2O7 — CID 118213852
methyl (6S)-6-[(1S)-1-(5-but-3-enylfuran-3-yl)-2-nitroethyl]-3,3-dimethyl-5-oxo-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxylate (PubChem CID 118213852) has the molecular formula C20H26N2O7 and a molecular weight of 406.44 g/mol. Its IUPAC name is methyl (6S)-6-[(1S)-1-(5-but-3-enylfuran-3-yl)-2-nitroethyl]-3,3-dimethyl-5-oxo-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxylate.
| Compound Name | methyl (6S)-6-[(1S)-1-(5-but-3-enylfuran-3-yl)-2-nitroethyl]-3,3-dimethyl-5-oxo-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 118213852 |
| Molecular Formula | C20H26N2O7 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | methyl (6S)-6-[(1S)-1-(5-but-3-enylfuran-3-yl)-2-nitroethyl]-3,3-dimethyl-5-oxo-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
| SMILES | C=CCCc1cc([C@H](C[N+](=O)[O-])[C@@]2(C(=O)OC)CC3COC(C)(C)N3C2=O)co1 |
| InChI | InChI=1S/C20H26N2O7/c1-5-6-7-15-8-13(11-28-15)16(10-21(25)26)20(18(24)27-4)9-14-12-29-19(2,3)22(14)17(20)23/h5,8,11,14,16H,1,6-7,9-10,12H2,2-4H3/t14?,16-,20-/m0/s1 |
| InChIKey | XJPKPDSOJZBLDK-XAXWGMKYSA-N |
| XLogP | 2.29 |
| TPSA | 112.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|