C10H10BrO2S- — CID 118213963
4-bromo-5,6,7,8-tetrahydronaphthalene-1-sulfinate (PubChem CID 118213963) has the molecular formula C10H10BrO2S- and a molecular weight of 274.16 g/mol. Its IUPAC name is 4-bromo-5,6,7,8-tetrahydronaphthalene-1-sulfinate.
| Compound Name | 4-bromo-5,6,7,8-tetrahydronaphthalene-1-sulfinate |
|---|---|
| PubChem CID | 118213963 |
| Molecular Formula | C10H10BrO2S- |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 272.96 |
| IUPAC Name | 4-bromo-5,6,7,8-tetrahydronaphthalene-1-sulfinate |
| SMILES | O=S([O-])c1ccc(Br)c2c1CCCC2 |
| InChI | InChI=1S/C10H11BrO2S/c11-9-5-6-10(14(12)13)8-4-2-1-3-7(8)9/h5-6H,1-4H2,(H,12,13)/p-1 |
| InChIKey | PFNGAIJNUWLFCT-UHFFFAOYSA-M |
| XLogP | 2.57 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|