About 5-(aziridin-1-yl)-2,3-bis(hydroxymethyl)-1-methylindole-4,7-dione
5-(aziridin-1-yl)-2,3-bis(hydroxymethyl)-1-methylindole-4,7-dione (PubChem CID 11821404) has the molecular formula C13H14N2O4
and a molecular weight of 262.26 g/mol. Its IUPAC name is 5-(aziridin-1-yl)-2,3-bis(hydroxymethyl)-1-methylindole-4,7-dione.
Molecular Properties
| Compound Name | 5-(aziridin-1-yl)-2,3-bis(hydroxymethyl)-1-methylindole-4,7-dione |
| PubChem CID | 11821404 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 5-(aziridin-1-yl)-2,3-bis(hydroxymethyl)-1-methylindole-4,7-dione |
| SMILES | Cn1c(CO)c(CO)c2c1C(=O)C=C(N1CC1)C2=O |
| InChI | InChI=1S/C13H14N2O4/c1-14-9(6-17)7(5-16)11-12(14)10(18)4-8(13(11)19)15-2-3-15/h4,16-17H,2-3,5-6H2,1H3 |
| InChIKey | LARXOTLQLKRKCF-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 82.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5-(aziridin-1-yl)-2,3-bis(hydroxymethyl)-1-methylindole-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aziridin-1-yl)-2,3-bis(hydroxymethyl)-1-methylindole-4,7-dione?
The IUPAC name of 5-(aziridin-1-yl)-2,3-bis(hydroxymethyl)-1-methylindole-4,7-dione (CID 11821404) is 5-(aziridin-1-yl)-2,3-bis(hydroxymethyl)-1-methylindole-4,7-dione.
What is the SMILES notation for 5-(aziridin-1-yl)-2,3-bis(hydroxymethyl)-1-methylindole-4,7-dione?
The canonical SMILES for 5-(aziridin-1-yl)-2,3-bis(hydroxymethyl)-1-methylindole-4,7-dione is Cn1c(CO)c(CO)c2c1C(=O)C=C(N1CC1)C2=O.
What is the InChIKey of 5-(aziridin-1-yl)-2,3-bis(hydroxymethyl)-1-methylindole-4,7-dione?
The InChIKey is LARXOTLQLKRKCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O4/c1-14-9(6-17)7(5-16)11-12(14)10(18)4-8(13(11)19)15-2-3-15/h4,16-17H,2-3,5-6H2,1H3.
What are the key properties of 5-(aziridin-1-yl)-2,3-bis(hydroxymethyl)-1-methylindole-4,7-dione?
5-(aziridin-1-yl)-2,3-bis(hydroxymethyl)-1-methylindole-4,7-dione has a molecular weight of 262.26 g/mol, XLogP of -0.41, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aziridin-1-yl)-2,3-bis(hydroxymethyl)-1-methylindole-4,7-dione is sourced from PubChem (CID 11821404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).