C12H22O6 — CID 11821409
(Z,4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-(methoxymethoxy)pent-2-ene-1,4-diol (PubChem CID 11821409) has the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. Its IUPAC name is (Z,4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-(methoxymethoxy)pent-2-ene-1,4-diol.
| Compound Name | (Z,4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-(methoxymethoxy)pent-2-ene-1,4-diol |
|---|---|
| PubChem CID | 11821409 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (Z,4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-(methoxymethoxy)pent-2-ene-1,4-diol |
| SMILES | COCO[C@@H]([C@H](O)/C=C\CO)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C12H22O6/c1-12(2)17-7-10(18-12)11(16-8-15-3)9(14)5-4-6-13/h4-5,9-11,13-14H,6-8H2,1-3H3/b5-4-/t9-,10-,11+/m1/s1 |
| InChIKey | OERFWVYNPRKREG-OFOQJXSYSA-N |
| XLogP | 0.04 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|