About 2-[4-[[(1S)-cyclohex-3-en-1-yl]methoxy]phenyl]-3,3-dimethyloxetane
2-[4-[[(1S)-cyclohex-3-en-1-yl]methoxy]phenyl]-3,3-dimethyloxetane (PubChem CID 118214174) has the molecular formula C18H24O2
and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-[4-[[(1S)-cyclohex-3-en-1-yl]methoxy]phenyl]-3,3-dimethyloxetane.
Molecular Properties
| Compound Name | 2-[4-[[(1S)-cyclohex-3-en-1-yl]methoxy]phenyl]-3,3-dimethyloxetane |
| PubChem CID | 118214174 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 2-[4-[[(1S)-cyclohex-3-en-1-yl]methoxy]phenyl]-3,3-dimethyloxetane |
| SMILES | CC1(C)COC1c1ccc(OC[C@@H]2CC=CCC2)cc1 |
| InChI | InChI=1S/C18H24O2/c1-18(2)13-20-17(18)15-8-10-16(11-9-15)19-12-14-6-4-3-5-7-14/h3-4,8-11,14,17H,5-7,12-13H2,1-2H3/t14-,17?/m1/s1 |
| InChIKey | ZMAKDJLIPQARID-XPCCGILXSA-N |
| XLogP | 4.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[[(1S)-cyclohex-3-en-1-yl]methoxy]phenyl]-3,3-dimethyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[[(1S)-cyclohex-3-en-1-yl]methoxy]phenyl]-3,3-dimethyloxetane?
The IUPAC name of 2-[4-[[(1S)-cyclohex-3-en-1-yl]methoxy]phenyl]-3,3-dimethyloxetane (CID 118214174) is 2-[4-[[(1S)-cyclohex-3-en-1-yl]methoxy]phenyl]-3,3-dimethyloxetane.
What is the SMILES notation for 2-[4-[[(1S)-cyclohex-3-en-1-yl]methoxy]phenyl]-3,3-dimethyloxetane?
The canonical SMILES for 2-[4-[[(1S)-cyclohex-3-en-1-yl]methoxy]phenyl]-3,3-dimethyloxetane is CC1(C)COC1c1ccc(OC[C@@H]2CC=CCC2)cc1.
What is the InChIKey of 2-[4-[[(1S)-cyclohex-3-en-1-yl]methoxy]phenyl]-3,3-dimethyloxetane?
The InChIKey is ZMAKDJLIPQARID-XPCCGILXSA-N. The full InChI is InChI=1S/C18H24O2/c1-18(2)13-20-17(18)15-8-10-16(11-9-15)19-12-14-6-4-3-5-7-14/h3-4,8-11,14,17H,5-7,12-13H2,1-2H3/t14-,17?/m1/s1.
What are the key properties of 2-[4-[[(1S)-cyclohex-3-en-1-yl]methoxy]phenyl]-3,3-dimethyloxetane?
2-[4-[[(1S)-cyclohex-3-en-1-yl]methoxy]phenyl]-3,3-dimethyloxetane has a molecular weight of 272.39 g/mol, XLogP of 4.52, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[[(1S)-cyclohex-3-en-1-yl]methoxy]phenyl]-3,3-dimethyloxetane is sourced from PubChem (CID 118214174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).