C17H25F2NO — CID 118214230
[2-[(4S)-6,6-difluoro-3,4-dimethylheptan-3-yl]oxy-3-methylphenyl]methanimine (PubChem CID 118214230) has the molecular formula C17H25F2NO and a molecular weight of 297.39 g/mol. Its IUPAC name is [2-[(4S)-6,6-difluoro-3,4-dimethylheptan-3-yl]oxy-3-methylphenyl]methanimine.
| Compound Name | [2-[(4S)-6,6-difluoro-3,4-dimethylheptan-3-yl]oxy-3-methylphenyl]methanimine |
|---|---|
| PubChem CID | 118214230 |
| Molecular Formula | C17H25F2NO |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | [2-[(4S)-6,6-difluoro-3,4-dimethylheptan-3-yl]oxy-3-methylphenyl]methanimine |
| SMILES | [H]/N=C/c1cccc(C)c1OC(C)(CC)[C@@H](C)CC(C)(F)F |
| InChI | InChI=1S/C17H25F2NO/c1-6-16(4,13(3)10-17(5,18)19)21-15-12(2)8-7-9-14(15)11-20/h7-9,11,13,20H,6,10H2,1-5H3/b20-11+/t13-,16?/m0/s1 |
| InChIKey | LGKWIHRKBUQCMA-LDOXXEEASA-N |
| XLogP | 5.22 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|