About (3-hydroxycyclohexyl)methyl 6,6-dimethylheptanoate
(3-hydroxycyclohexyl)methyl 6,6-dimethylheptanoate (PubChem CID 118214260) has the molecular formula C16H30O3
and a molecular weight of 270.41 g/mol. Its IUPAC name is (3-hydroxycyclohexyl)methyl 6,6-dimethylheptanoate.
Molecular Properties
| Compound Name | (3-hydroxycyclohexyl)methyl 6,6-dimethylheptanoate |
| PubChem CID | 118214260 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | (3-hydroxycyclohexyl)methyl 6,6-dimethylheptanoate |
| SMILES | CC(C)(C)CCCCC(=O)OCC1CCCC(O)C1 |
| InChI | InChI=1S/C16H30O3/c1-16(2,3)10-5-4-9-15(18)19-12-13-7-6-8-14(17)11-13/h13-14,17H,4-12H2,1-3H3 |
| InChIKey | BXJZQZBVGREZFA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxycyclohexyl)methyl 6,6-dimethylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxycyclohexyl)methyl 6,6-dimethylheptanoate?
The IUPAC name of (3-hydroxycyclohexyl)methyl 6,6-dimethylheptanoate (CID 118214260) is (3-hydroxycyclohexyl)methyl 6,6-dimethylheptanoate.
What is the SMILES notation for (3-hydroxycyclohexyl)methyl 6,6-dimethylheptanoate?
The canonical SMILES for (3-hydroxycyclohexyl)methyl 6,6-dimethylheptanoate is CC(C)(C)CCCCC(=O)OCC1CCCC(O)C1.
What is the InChIKey of (3-hydroxycyclohexyl)methyl 6,6-dimethylheptanoate?
The InChIKey is BXJZQZBVGREZFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O3/c1-16(2,3)10-5-4-9-15(18)19-12-13-7-6-8-14(17)11-13/h13-14,17H,4-12H2,1-3H3.
What are the key properties of (3-hydroxycyclohexyl)methyl 6,6-dimethylheptanoate?
(3-hydroxycyclohexyl)methyl 6,6-dimethylheptanoate has a molecular weight of 270.41 g/mol, XLogP of 3.69, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxycyclohexyl)methyl 6,6-dimethylheptanoate is sourced from PubChem (CID 118214260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).