About 3,7-dimethyl-6-phenylsulfanylocta-1,7-dien-3-ol
3,7-dimethyl-6-phenylsulfanylocta-1,7-dien-3-ol (PubChem CID 11821428) has the molecular formula C16H22OS
and a molecular weight of 262.42 g/mol. Its IUPAC name is 3,7-dimethyl-6-phenylsulfanylocta-1,7-dien-3-ol.
Molecular Properties
| Compound Name | 3,7-dimethyl-6-phenylsulfanylocta-1,7-dien-3-ol |
| PubChem CID | 11821428 |
| Molecular Formula | C16H22OS |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3,7-dimethyl-6-phenylsulfanylocta-1,7-dien-3-ol |
| SMILES | C=CC(C)(O)CCC(Sc1ccccc1)C(=C)C |
| InChI | InChI=1S/C16H22OS/c1-5-16(4,17)12-11-15(13(2)3)18-14-9-7-6-8-10-14/h5-10,15,17H,1-2,11-12H2,3-4H3 |
| InChIKey | SFVQTGYPDCPPQX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyl-6-phenylsulfanylocta-1,7-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-6-phenylsulfanylocta-1,7-dien-3-ol?
The IUPAC name of 3,7-dimethyl-6-phenylsulfanylocta-1,7-dien-3-ol (CID 11821428) is 3,7-dimethyl-6-phenylsulfanylocta-1,7-dien-3-ol.
What is the SMILES notation for 3,7-dimethyl-6-phenylsulfanylocta-1,7-dien-3-ol?
The canonical SMILES for 3,7-dimethyl-6-phenylsulfanylocta-1,7-dien-3-ol is C=CC(C)(O)CCC(Sc1ccccc1)C(=C)C.
What is the InChIKey of 3,7-dimethyl-6-phenylsulfanylocta-1,7-dien-3-ol?
The InChIKey is SFVQTGYPDCPPQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22OS/c1-5-16(4,17)12-11-15(13(2)3)18-14-9-7-6-8-10-14/h5-10,15,17H,1-2,11-12H2,3-4H3.
What are the key properties of 3,7-dimethyl-6-phenylsulfanylocta-1,7-dien-3-ol?
3,7-dimethyl-6-phenylsulfanylocta-1,7-dien-3-ol has a molecular weight of 262.42 g/mol, XLogP of 4.44, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-6-phenylsulfanylocta-1,7-dien-3-ol is sourced from PubChem (CID 11821428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).