C7H12N2O — CID 118214307
(3aR,6aS)-5-methyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-4-one (PubChem CID 118214307) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is (3aR,6aS)-5-methyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-4-one.
| Compound Name | (3aR,6aS)-5-methyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-4-one |
|---|---|
| PubChem CID | 118214307 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | (3aR,6aS)-5-methyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-4-one |
| SMILES | CN1C[C@@H]2CNC[C@@H]2C1=O |
| InChI | InChI=1S/C7H12N2O/c1-9-4-5-2-8-3-6(5)7(9)10/h5-6,8H,2-4H2,1H3/t5-,6-/m0/s1 |
| InChIKey | FITYIFCGCNWDQG-WDSKDSINSA-N |
| XLogP | -0.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |