C14H19ClN4O — CID 118214358
(7aS)-2-chloro-7-cyclopentyl-N,N-dimethyl-3,7a-dihydropyrrolo[2,3-d]pyrimidine-6-carboxamide (PubChem CID 118214358) has the molecular formula C14H19ClN4O and a molecular weight of 294.79 g/mol. Its IUPAC name is (7aS)-2-chloro-7-cyclopentyl-N,N-dimethyl-3,7a-dihydropyrrolo[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | (7aS)-2-chloro-7-cyclopentyl-N,N-dimethyl-3,7a-dihydropyrrolo[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 118214358 |
| Molecular Formula | C14H19ClN4O |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (7aS)-2-chloro-7-cyclopentyl-N,N-dimethyl-3,7a-dihydropyrrolo[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CN(C)C(=O)C1=CC2=CNC(Cl)=N[C@@H]2N1C1CCCC1 |
| InChI | InChI=1S/C14H19ClN4O/c1-18(2)13(20)11-7-9-8-16-14(15)17-12(9)19(11)10-5-3-4-6-10/h7-8,10,12H,3-6H2,1-2H3,(H,16,17)/t12-/m1/s1 |
| InChIKey | TVYVMGKMAROWLZ-GFCCVEGCSA-N |
| XLogP | 1.62 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|