C37H31N — CID 118214461
7,7-dimethyl-5-(7,9,9-trimethylfluoren-2-yl)indeno[2,1-b]carbazole (PubChem CID 118214461) has the molecular formula C37H31N and a molecular weight of 489.66 g/mol. Its IUPAC name is 7,7-dimethyl-5-(7,9,9-trimethylfluoren-2-yl)indeno[2,1-b]carbazole.
| Compound Name | 7,7-dimethyl-5-(7,9,9-trimethylfluoren-2-yl)indeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 118214461 |
| Molecular Formula | C37H31N |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 7,7-dimethyl-5-(7,9,9-trimethylfluoren-2-yl)indeno[2,1-b]carbazole |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(-n3c4ccccc4c4cc5c(cc43)C(C)(C)c3ccccc3-5)ccc1-2 |
| InChI | InChI=1S/C37H31N/c1-22-14-16-25-26-17-15-23(19-32(26)37(4,5)31(25)18-22)38-34-13-9-7-11-27(34)29-20-28-24-10-6-8-12-30(24)36(2,3)33(28)21-35(29)38/h6-21H,1-5H3 |
| InChIKey | KVGPNNGAZYSGGG-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |