C18H24N2O2 — CID 118214811
2-[(3aS,4S,6R,6aR)-5-benzyl-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]acetonitrile (PubChem CID 118214811) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-[(3aS,4S,6R,6aR)-5-benzyl-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]acetonitrile.
| Compound Name | 2-[(3aS,4S,6R,6aR)-5-benzyl-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]acetonitrile |
|---|---|
| PubChem CID | 118214811 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-[(3aS,4S,6R,6aR)-5-benzyl-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]acetonitrile |
| SMILES | CC[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@H](CC#N)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H24N2O2/c1-4-14-16-17(22-18(2,3)21-16)15(10-11-19)20(14)12-13-8-6-5-7-9-13/h5-9,14-17H,4,10,12H2,1-3H3/t14-,15+,16-,17+/m1/s1 |
| InChIKey | NTVSMNJTLFFPSX-TWMKSMIVSA-N |
| XLogP | 3.08 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |