C28H21F5N6O2 — CID 118215137
1-(2,4-difluorophenyl)-8-[5-pyridin-3-yl-1-(3,4,5-trifluorophenyl)pyrazole-3-carbonyl]-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 118215137) has the molecular formula C28H21F5N6O2 and a molecular weight of 568.51 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-8-[5-pyridin-3-yl-1-(3,4,5-trifluorophenyl)pyrazole-3-carbonyl]-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 1-(2,4-difluorophenyl)-8-[5-pyridin-3-yl-1-(3,4,5-trifluorophenyl)pyrazole-3-carbonyl]-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 118215137 |
| Molecular Formula | C28H21F5N6O2 |
| Molecular Weight | 568.51 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 1-(2,4-difluorophenyl)-8-[5-pyridin-3-yl-1-(3,4,5-trifluorophenyl)pyrazole-3-carbonyl]-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | O=C(c1cc(-c2cccnc2)n(-c2cc(F)c(F)c(F)c2)n1)N1CCC2(CC1)C(=O)NCN2c1ccc(F)cc1F |
| InChI | InChI=1S/C28H21F5N6O2/c29-17-3-4-23(19(30)10-17)38-15-35-27(41)28(38)5-8-37(9-6-28)26(40)22-13-24(16-2-1-7-34-14-16)39(36-22)18-11-20(31)25(33)21(32)12-18/h1-4,7,10-14H,5-6,8-9,15H2,(H,35,41) |
| InChIKey | MBWAJJGULXICSV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|