C18H16F13NO3 — CID 118215214
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl 3-(4-hydroxy-N-methylanilino)propanoate (PubChem CID 118215214) has the molecular formula C18H16F13NO3 and a molecular weight of 541.30 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl 3-(4-hydroxy-N-methylanilino)propanoate.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl 3-(4-hydroxy-N-methylanilino)propanoate |
|---|---|
| PubChem CID | 118215214 |
| Molecular Formula | C18H16F13NO3 |
| Molecular Weight | 541.30 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl 3-(4-hydroxy-N-methylanilino)propanoate |
| SMILES | CN(CCC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H16F13NO3/c1-32(10-2-4-11(33)5-3-10)8-6-12(34)35-9-7-13(19,20)14(21,22)15(23,24)16(25,26)17(27,28)18(29,30)31/h2-5,33H,6-9H2,1H3 |
| InChIKey | DGBREXDZCWPOCZ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.30 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|