About 2-fluoroethyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate
2-fluoroethyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate (PubChem CID 118215254) has the molecular formula C6H7FN2O2S3
and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-fluoroethyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate.
Molecular Properties
| Compound Name | 2-fluoroethyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate |
| PubChem CID | 118215254 |
| Molecular Formula | C6H7FN2O2S3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | 2-fluoroethyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate |
| SMILES | O=C(CSc1n[nH]c(=S)s1)OCCF |
| InChI | InChI=1S/C6H7FN2O2S3/c7-1-2-11-4(10)3-13-6-9-8-5(12)14-6/h1-3H2,(H,8,12) |
| InChIKey | AVGHQHQGTRWZMH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroethyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate?
The IUPAC name of 2-fluoroethyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate (CID 118215254) is 2-fluoroethyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate.
What is the SMILES notation for 2-fluoroethyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate?
The canonical SMILES for 2-fluoroethyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate is O=C(CSc1n[nH]c(=S)s1)OCCF.
What is the InChIKey of 2-fluoroethyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate?
The InChIKey is AVGHQHQGTRWZMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7FN2O2S3/c7-1-2-11-4(10)3-13-6-9-8-5(12)14-6/h1-3H2,(H,8,12).
What are the key properties of 2-fluoroethyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate?
2-fluoroethyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate has a molecular weight of 254.33 g/mol, XLogP of 1.81, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate is sourced from PubChem (CID 118215254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).