About ethyl 2-(dibenzylamino)-2,2-difluoroacetate
ethyl 2-(dibenzylamino)-2,2-difluoroacetate (PubChem CID 118215454) has the molecular formula C18H19F2NO2
and a molecular weight of 319.35 g/mol. Its IUPAC name is ethyl 2-(dibenzylamino)-2,2-difluoroacetate.
Molecular Properties
| Compound Name | ethyl 2-(dibenzylamino)-2,2-difluoroacetate |
| PubChem CID | 118215454 |
| Molecular Formula | C18H19F2NO2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | ethyl 2-(dibenzylamino)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H19F2NO2/c1-2-23-17(22)18(19,20)21(13-15-9-5-3-6-10-15)14-16-11-7-4-8-12-16/h3-12H,2,13-14H2,1H3 |
| InChIKey | GAPPBSCUMYPCIA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(dibenzylamino)-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(dibenzylamino)-2,2-difluoroacetate?
The IUPAC name of ethyl 2-(dibenzylamino)-2,2-difluoroacetate (CID 118215454) is ethyl 2-(dibenzylamino)-2,2-difluoroacetate.
What is the SMILES notation for ethyl 2-(dibenzylamino)-2,2-difluoroacetate?
The canonical SMILES for ethyl 2-(dibenzylamino)-2,2-difluoroacetate is CCOC(=O)C(F)(F)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of ethyl 2-(dibenzylamino)-2,2-difluoroacetate?
The InChIKey is GAPPBSCUMYPCIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F2NO2/c1-2-23-17(22)18(19,20)21(13-15-9-5-3-6-10-15)14-16-11-7-4-8-12-16/h3-12H,2,13-14H2,1H3.
What are the key properties of ethyl 2-(dibenzylamino)-2,2-difluoroacetate?
ethyl 2-(dibenzylamino)-2,2-difluoroacetate has a molecular weight of 319.35 g/mol, XLogP of 3.84, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(dibenzylamino)-2,2-difluoroacetate is sourced from PubChem (CID 118215454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).