C18H19BrN2O4S — CID 1182155
ethyl 2-[2-[3-(5-bromo-2-ethoxyphenyl)prop-2-enoylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 1182155) has the molecular formula C18H19BrN2O4S and a molecular weight of 439.33 g/mol. Its IUPAC name is ethyl 2-[2-[3-(5-bromo-2-ethoxyphenyl)prop-2-enoylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[3-(5-bromo-2-ethoxyphenyl)prop-2-enoylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 1182155 |
| Molecular Formula | C18H19BrN2O4S |
| Molecular Weight | 439.33 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | ethyl 2-[2-[3-(5-bromo-2-ethoxyphenyl)prop-2-enoylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)C=Cc2cc(Br)ccc2OCC)n1 |
| InChI | InChI=1S/C18H19BrN2O4S/c1-3-24-15-7-6-13(19)9-12(15)5-8-16(22)21-18-20-14(11-26-18)10-17(23)25-4-2/h5-9,11H,3-4,10H2,1-2H3,(H,20,21,22) |
| InChIKey | YCZLVTQFPUOWEF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|