About N-[(5-cyclopenta-1,3-dien-1-ylfuran-2-yl)methyl]adamantan-1-amine
N-[(5-cyclopenta-1,3-dien-1-ylfuran-2-yl)methyl]adamantan-1-amine (PubChem CID 118215691) has the molecular formula C20H25NO
and a molecular weight of 295.43 g/mol. Its IUPAC name is N-[(5-cyclopenta-1,3-dien-1-ylfuran-2-yl)methyl]adamantan-1-amine.
Molecular Properties
| Compound Name | N-[(5-cyclopenta-1,3-dien-1-ylfuran-2-yl)methyl]adamantan-1-amine |
| PubChem CID | 118215691 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N-[(5-cyclopenta-1,3-dien-1-ylfuran-2-yl)methyl]adamantan-1-amine |
| SMILES | C1=CCC(c2ccc(CNC34CC5CC(CC(C5)C3)C4)o2)=C1 |
| InChI | InChI=1S/C20H25NO/c1-2-4-17(3-1)19-6-5-18(22-19)13-21-20-10-14-7-15(11-20)9-16(8-14)12-20/h1-3,5-6,14-16,21H,4,7-13H2 |
| InChIKey | UQEUSDJWQLQFNY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(5-cyclopenta-1,3-dien-1-ylfuran-2-yl)methyl]adamantan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-cyclopenta-1,3-dien-1-ylfuran-2-yl)methyl]adamantan-1-amine?
The IUPAC name of N-[(5-cyclopenta-1,3-dien-1-ylfuran-2-yl)methyl]adamantan-1-amine (CID 118215691) is N-[(5-cyclopenta-1,3-dien-1-ylfuran-2-yl)methyl]adamantan-1-amine.
What is the SMILES notation for N-[(5-cyclopenta-1,3-dien-1-ylfuran-2-yl)methyl]adamantan-1-amine?
The canonical SMILES for N-[(5-cyclopenta-1,3-dien-1-ylfuran-2-yl)methyl]adamantan-1-amine is C1=CCC(c2ccc(CNC34CC5CC(CC(C5)C3)C4)o2)=C1.
What is the InChIKey of N-[(5-cyclopenta-1,3-dien-1-ylfuran-2-yl)methyl]adamantan-1-amine?
The InChIKey is UQEUSDJWQLQFNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO/c1-2-4-17(3-1)19-6-5-18(22-19)13-21-20-10-14-7-15(11-20)9-16(8-14)12-20/h1-3,5-6,14-16,21H,4,7-13H2.
What are the key properties of N-[(5-cyclopenta-1,3-dien-1-ylfuran-2-yl)methyl]adamantan-1-amine?
N-[(5-cyclopenta-1,3-dien-1-ylfuran-2-yl)methyl]adamantan-1-amine has a molecular weight of 295.43 g/mol, XLogP of 4.68, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-cyclopenta-1,3-dien-1-ylfuran-2-yl)methyl]adamantan-1-amine is sourced from PubChem (CID 118215691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).