C9H5Cl3O4S — CID 118215743
3-(2,4,5-trichloro-3,6-dioxocyclohexa-1,4-dien-1-yl)sulfanylpropanoic acid (PubChem CID 118215743) has the molecular formula C9H5Cl3O4S and a molecular weight of 315.56 g/mol. Its IUPAC name is 3-(2,4,5-trichloro-3,6-dioxocyclohexa-1,4-dien-1-yl)sulfanylpropanoic acid.
| Compound Name | 3-(2,4,5-trichloro-3,6-dioxocyclohexa-1,4-dien-1-yl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 118215743 |
| Molecular Formula | C9H5Cl3O4S |
| Molecular Weight | 315.56 g/mol |
| Exact Mass | 313.90 |
| IUPAC Name | 3-(2,4,5-trichloro-3,6-dioxocyclohexa-1,4-dien-1-yl)sulfanylpropanoic acid |
| SMILES | O=C(O)CCSC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O |
| InChI | InChI=1S/C9H5Cl3O4S/c10-4-5(11)8(16)9(6(12)7(4)15)17-2-1-3(13)14/h1-2H2,(H,13,14) |
| InChIKey | LPPGXMLQSUHCFG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.56 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|