C22H21ClN2O2 — CID 118215955
4-[1-[(2-chloro-6-methylphenyl)methyl]indazol-3-yl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 118215955) has the molecular formula C22H21ClN2O2 and a molecular weight of 380.88 g/mol. Its IUPAC name is 4-[1-[(2-chloro-6-methylphenyl)methyl]indazol-3-yl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 4-[1-[(2-chloro-6-methylphenyl)methyl]indazol-3-yl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 118215955 |
| Molecular Formula | C22H21ClN2O2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 4-[1-[(2-chloro-6-methylphenyl)methyl]indazol-3-yl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | Cc1cccc(Cl)c1Cn1nc(C2=CCC(C(=O)O)CC2)c2ccccc21 |
| InChI | InChI=1S/C22H21ClN2O2/c1-14-5-4-7-19(23)18(14)13-25-20-8-3-2-6-17(20)21(24-25)15-9-11-16(12-10-15)22(26)27/h2-9,16H,10-13H2,1H3,(H,26,27) |
| InChIKey | LMGGKSNGEYAROQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |